C16H21BrN2O2 — CID 103260544
4-[(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)methyl]-3-bromobenzoic acid (PubChem CID 103260544) has the molecular formula C16H21BrN2O2 and a molecular weight of 353.26 g/mol. Its IUPAC name is 4-[(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)methyl]-3-bromobenzoic acid.
| Compound Name | 4-[(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)methyl]-3-bromobenzoic acid |
|---|---|
| PubChem CID | 103260544 |
| Molecular Formula | C16H21BrN2O2 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 4-[(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)methyl]-3-bromobenzoic acid |
| SMILES | O=C(O)c1ccc(CNC2CCN3CCCC3C2)c(Br)c1 |
| InChI | InChI=1S/C16H21BrN2O2/c17-15-8-11(16(20)21)3-4-12(15)10-18-13-5-7-19-6-1-2-14(19)9-13/h3-4,8,13-14,18H,1-2,5-7,9-10H2,(H,20,21) |
| InChIKey | UVGALHXKUKOVEQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |