C16H23N3O — CID 78921069
3-[(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)methyl]benzamide (PubChem CID 78921069) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 3-[(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)methyl]benzamide.
| Compound Name | 3-[(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)methyl]benzamide |
|---|---|
| PubChem CID | 78921069 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 3-[(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)methyl]benzamide |
| SMILES | NC(=O)c1cccc(CNC2CCN3CCCC3C2)c1 |
| InChI | InChI=1S/C16H23N3O/c17-16(20)13-4-1-3-12(9-13)11-18-14-6-8-19-7-2-5-15(19)10-14/h1,3-4,9,14-15,18H,2,5-8,10-11H2,(H2,17,20) |
| InChIKey | CDYAHNPPWMKWFH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |