C12H18N2O2S — CID 80639695
methyl 2-[[5-(ethylaminomethyl)-3-methyl-2-pyridinyl]sulfanyl]acetate (PubChem CID 80639695) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is methyl 2-[[5-(ethylaminomethyl)-3-methyl-2-pyridinyl]sulfanyl]acetate.
| Compound Name | methyl 2-[[5-(ethylaminomethyl)-3-methyl-2-pyridinyl]sulfanyl]acetate |
|---|---|
| PubChem CID | 80639695 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | methyl 2-[[5-(ethylaminomethyl)-3-methyl-2-pyridinyl]sulfanyl]acetate |
| SMILES | CCNCc1cnc(SCC(=O)OC)c(C)c1 |
| InChI | InChI=1S/C12H18N2O2S/c1-4-13-6-10-5-9(2)12(14-7-10)17-8-11(15)16-3/h5,7,13H,4,6,8H2,1-3H3 |
| InChIKey | NEZJUYZPAGIIOA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |