C37H31N5O6S4 — CID 5185745
4-[8,16-bis-(4-methylphenyl)sulfonyl-8,16,17-triazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaen-17-yl]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 5185745) has the molecular formula C37H31N5O6S4 and a molecular weight of 769.95 g/mol. Its IUPAC name is 4-[8,16-bis-(4-methylphenyl)sulfonyl-8,16,17-triazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaen-17-yl]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[8,16-bis-(4-methylphenyl)sulfonyl-8,16,17-triazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaen-17-yl]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 5185745 |
| Molecular Formula | C37H31N5O6S4 |
| Molecular Weight | 769.95 g/mol |
| Exact Mass | 769.12 |
| IUPAC Name | 4-[8,16-bis-(4-methylphenyl)sulfonyl-8,16,17-triazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaen-17-yl]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N2c3ccccc3C3N(c4ccc(S(=O)(=O)Nc5nccs5)cc4)C2c2ccccc2N3S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C37H31N5O6S4/c1-25-11-17-29(18-12-25)51(45,46)41-33-9-5-3-7-31(33)36-40(27-15-21-28(22-16-27)50(43,44)39-37-38-23-24-49-37)35(41)32-8-4-6-10-34(32)42(36)52(47,48)30-19-13-26(2)14-20-30/h3-24,35-36H,1-2H3,(H,38,39) |
| InChIKey | WKKSHWBSPRWEJC-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 137.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.95 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |