C21H28N3O5S+ — CID 177360691
triethyl-[2-hydroxy-1-(4-methylphenyl)sulfonyl-5-nitro-2,3-dihydroindol-3-yl]azanium (PubChem CID 177360691) has the molecular formula C21H28N3O5S+ and a molecular weight of 434.54 g/mol. Its IUPAC name is triethyl-[2-hydroxy-1-(4-methylphenyl)sulfonyl-5-nitro-2,3-dihydroindol-3-yl]azanium.
| Compound Name | triethyl-[2-hydroxy-1-(4-methylphenyl)sulfonyl-5-nitro-2,3-dihydroindol-3-yl]azanium |
|---|---|
| PubChem CID | 177360691 |
| Molecular Formula | C21H28N3O5S+ |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | triethyl-[2-hydroxy-1-(4-methylphenyl)sulfonyl-5-nitro-2,3-dihydroindol-3-yl]azanium |
| SMILES | CC[N+](CC)(CC)C1c2cc([N+](=O)[O-])ccc2N(S(=O)(=O)c2ccc(C)cc2)C1O |
| InChI | InChI=1S/C21H28N3O5S/c1-5-24(6-2,7-3)20-18-14-16(23(26)27)10-13-19(18)22(21(20)25)30(28,29)17-11-8-15(4)9-12-17/h8-14,20-21,25H,5-7H2,1-4H3/q+1 |
| InChIKey | KZXSSFBJVBJEEY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|