C20H19N3O8S — CID 139189880
(4R,4aR,9aS)-4-methoxy-9-(4-methylphenyl)sulfonyl-4a,6-dinitro-1,3,4,9a-tetrahydrocarbazol-2-one (PubChem CID 139189880) has the molecular formula C20H19N3O8S and a molecular weight of 461.45 g/mol. Its IUPAC name is (4R,4aR,9aS)-4-methoxy-9-(4-methylphenyl)sulfonyl-4a,6-dinitro-1,3,4,9a-tetrahydrocarbazol-2-one.
| Compound Name | (4R,4aR,9aS)-4-methoxy-9-(4-methylphenyl)sulfonyl-4a,6-dinitro-1,3,4,9a-tetrahydrocarbazol-2-one |
|---|---|
| PubChem CID | 139189880 |
| Molecular Formula | C20H19N3O8S |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | (4R,4aR,9aS)-4-methoxy-9-(4-methylphenyl)sulfonyl-4a,6-dinitro-1,3,4,9a-tetrahydrocarbazol-2-one |
| SMILES | CO[C@@H]1CC(=O)C[C@@H]2N(S(=O)(=O)c3ccc(C)cc3)c3ccc([N+](=O)[O-])cc3[C@@]21[N+](=O)[O-] |
| InChI | InChI=1S/C20H19N3O8S/c1-12-3-6-15(7-4-12)32(29,30)21-17-8-5-13(22(25)26)9-16(17)20(23(27)28)18(21)10-14(24)11-19(20)31-2/h3-9,18-19H,10-11H2,1-2H3/t18-,19+,20+/m0/s1 |
| InChIKey | XPMKWCKKIRTUJN-XUVXKRRUSA-N |
| XLogP | 2.33 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|