C22H18N4O4S — CID 172908256
(1R,3aS,8bR)-1-ethenyl-4-(4-methylphenyl)sulfonyl-8b-nitro-2,3a-dihydro-1H-cyclopenta[b]indole-3,3-dicarbonitrile (PubChem CID 172908256) has the molecular formula C22H18N4O4S and a molecular weight of 434.48 g/mol. Its IUPAC name is (1R,3aS,8bR)-1-ethenyl-4-(4-methylphenyl)sulfonyl-8b-nitro-2,3a-dihydro-1H-cyclopenta[b]indole-3,3-dicarbonitrile.
| Compound Name | (1R,3aS,8bR)-1-ethenyl-4-(4-methylphenyl)sulfonyl-8b-nitro-2,3a-dihydro-1H-cyclopenta[b]indole-3,3-dicarbonitrile |
|---|---|
| PubChem CID | 172908256 |
| Molecular Formula | C22H18N4O4S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | (1R,3aS,8bR)-1-ethenyl-4-(4-methylphenyl)sulfonyl-8b-nitro-2,3a-dihydro-1H-cyclopenta[b]indole-3,3-dicarbonitrile |
| SMILES | C=C[C@H]1CC(C#N)(C#N)[C@@H]2N(S(=O)(=O)c3ccc(C)cc3)c3ccccc3[C@]12[N+](=O)[O-] |
| InChI | InChI=1S/C22H18N4O4S/c1-3-16-12-21(13-23,14-24)20-22(16,26(27)28)18-6-4-5-7-19(18)25(20)31(29,30)17-10-8-15(2)9-11-17/h3-11,16,20H,1,12H2,2H3/t16-,20-,22+/m0/s1 |
| InChIKey | FZXQSMANDLDLOW-XUEUYAKLSA-N |
| XLogP | 3.28 |
| TPSA | 128.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|