C24H27N3O5S — CID 10695655
N-[(4R,4aS,9aS)-9-(4-methylphenyl)sulfonyl-4a-nitro-4,9a-dihydro-1H-carbazol-4-yl]-N-propylacetamide (PubChem CID 10695655) has the molecular formula C24H27N3O5S and a molecular weight of 469.56 g/mol. Its IUPAC name is N-[(4R,4aS,9aS)-9-(4-methylphenyl)sulfonyl-4a-nitro-4,9a-dihydro-1H-carbazol-4-yl]-N-propylacetamide.
| Compound Name | N-[(4R,4aS,9aS)-9-(4-methylphenyl)sulfonyl-4a-nitro-4,9a-dihydro-1H-carbazol-4-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 10695655 |
| Molecular Formula | C24H27N3O5S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | N-[(4R,4aS,9aS)-9-(4-methylphenyl)sulfonyl-4a-nitro-4,9a-dihydro-1H-carbazol-4-yl]-N-propylacetamide |
| SMILES | CCCN(C(C)=O)[C@@H]1C=CC[C@@H]2N(S(=O)(=O)c3ccc(C)cc3)c3ccccc3[C@@]21[N+](=O)[O-] |
| InChI | InChI=1S/C24H27N3O5S/c1-4-16-25(18(3)28)22-10-7-11-23-24(22,27(29)30)20-8-5-6-9-21(20)26(23)33(31,32)19-14-12-17(2)13-15-19/h5-10,12-15,22-23H,4,11,16H2,1-3H3/t22-,23+,24+/m1/s1 |
| InChIKey | QZSIGMWCKUUXJV-SGNDLWITSA-N |
| XLogP | 3.63 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|