C27H28N2O6S — CID 134948613
ethyl 2-[(2R,3S,4R)-3-methyl-1-(4-methylphenyl)sulfonyl-3-nitro-2-phenyl-2,4-dihydroquinolin-4-yl]acetate (PubChem CID 134948613) has the molecular formula C27H28N2O6S and a molecular weight of 508.60 g/mol. Its IUPAC name is ethyl 2-[(2R,3S,4R)-3-methyl-1-(4-methylphenyl)sulfonyl-3-nitro-2-phenyl-2,4-dihydroquinolin-4-yl]acetate.
| Compound Name | ethyl 2-[(2R,3S,4R)-3-methyl-1-(4-methylphenyl)sulfonyl-3-nitro-2-phenyl-2,4-dihydroquinolin-4-yl]acetate |
|---|---|
| PubChem CID | 134948613 |
| Molecular Formula | C27H28N2O6S |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | ethyl 2-[(2R,3S,4R)-3-methyl-1-(4-methylphenyl)sulfonyl-3-nitro-2-phenyl-2,4-dihydroquinolin-4-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1c2ccccc2N(S(=O)(=O)c2ccc(C)cc2)[C@H](c2ccccc2)[C@@]1(C)[N+](=O)[O-] |
| InChI | InChI=1S/C27H28N2O6S/c1-4-35-25(30)18-23-22-12-8-9-13-24(22)28(36(33,34)21-16-14-19(2)15-17-21)26(27(23,3)29(31)32)20-10-6-5-7-11-20/h5-17,23,26H,4,18H2,1-3H3/t23-,26-,27+/m1/s1 |
| InChIKey | YXJGSGQIILGECK-MVNQZMKCSA-N |
| XLogP | 5.02 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|