C26H25ClN2O6S — CID 122221098
ethyl 2-[(2R,3S,4R)-7-chloro-1-(4-methylphenyl)sulfonyl-3-nitro-2-phenyl-3,4-dihydro-2H-quinolin-4-yl]acetate (PubChem CID 122221098) has the molecular formula C26H25ClN2O6S and a molecular weight of 529.01 g/mol. Its IUPAC name is ethyl 2-[(2R,3S,4R)-7-chloro-1-(4-methylphenyl)sulfonyl-3-nitro-2-phenyl-3,4-dihydro-2H-quinolin-4-yl]acetate.
| Compound Name | ethyl 2-[(2R,3S,4R)-7-chloro-1-(4-methylphenyl)sulfonyl-3-nitro-2-phenyl-3,4-dihydro-2H-quinolin-4-yl]acetate |
|---|---|
| PubChem CID | 122221098 |
| Molecular Formula | C26H25ClN2O6S |
| Molecular Weight | 529.01 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | ethyl 2-[(2R,3S,4R)-7-chloro-1-(4-methylphenyl)sulfonyl-3-nitro-2-phenyl-3,4-dihydro-2H-quinolin-4-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1c2ccc(Cl)cc2N(S(=O)(=O)c2ccc(C)cc2)[C@H](c2ccccc2)[C@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C26H25ClN2O6S/c1-3-35-24(30)16-22-21-14-11-19(27)15-23(21)28(36(33,34)20-12-9-17(2)10-13-20)25(26(22)29(31)32)18-7-5-4-6-8-18/h4-15,22,25-26H,3,16H2,1-2H3/t22-,25-,26+/m1/s1 |
| InChIKey | RNDXTOLRCFIOSO-RCXJIHSJSA-N |
| XLogP | 5.28 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.01 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|