C17H17BrClNO3S — CID 177386607
(2R,3S)-3-bromo-5-chloro-2-ethoxy-1-(4-methylphenyl)sulfonyl-2,3-dihydroindole (PubChem CID 177386607) has the molecular formula C17H17BrClNO3S and a molecular weight of 430.75 g/mol. Its IUPAC name is (2R,3S)-3-bromo-5-chloro-2-ethoxy-1-(4-methylphenyl)sulfonyl-2,3-dihydroindole.
| Compound Name | (2R,3S)-3-bromo-5-chloro-2-ethoxy-1-(4-methylphenyl)sulfonyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 177386607 |
| Molecular Formula | C17H17BrClNO3S |
| Molecular Weight | 430.75 g/mol |
| Exact Mass | 428.98 |
| IUPAC Name | (2R,3S)-3-bromo-5-chloro-2-ethoxy-1-(4-methylphenyl)sulfonyl-2,3-dihydroindole |
| SMILES | CCO[C@@H]1[C@@H](Br)c2cc(Cl)ccc2N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H17BrClNO3S/c1-3-23-17-16(18)14-10-12(19)6-9-15(14)20(17)24(21,22)13-7-4-11(2)5-8-13/h4-10,16-17H,3H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | BEXYJKVANIHMSE-DLBZAZTESA-N |
| XLogP | 4.66 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.75 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|