C21H25BClNO4S — CID 178201418
5-chloro-1-(4-methylphenyl)sulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole (PubChem CID 178201418) has the molecular formula C21H25BClNO4S and a molecular weight of 433.77 g/mol. Its IUPAC name is 5-chloro-1-(4-methylphenyl)sulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole.
| Compound Name | 5-chloro-1-(4-methylphenyl)sulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 178201418 |
| Molecular Formula | C21H25BClNO4S |
| Molecular Weight | 433.77 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 5-chloro-1-(4-methylphenyl)sulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(B3OC(C)(C)C(C)(C)O3)c3cc(Cl)ccc32)cc1 |
| InChI | InChI=1S/C21H25BClNO4S/c1-14-6-9-16(10-7-14)29(25,26)24-13-18(17-12-15(23)8-11-19(17)24)22-27-20(2,3)21(4,5)28-22/h6-12,18H,13H2,1-5H3 |
| InChIKey | FPJIWXTZZCZRPD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.77 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|