C23H30BNO4S — CID 122216135
5-methyl-1-(4-methylphenyl)sulfonyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-2,3-dihydroindole (PubChem CID 122216135) has the molecular formula C23H30BNO4S and a molecular weight of 427.38 g/mol. Its IUPAC name is 5-methyl-1-(4-methylphenyl)sulfonyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-2,3-dihydroindole.
| Compound Name | 5-methyl-1-(4-methylphenyl)sulfonyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-2,3-dihydroindole |
|---|---|
| PubChem CID | 122216135 |
| Molecular Formula | C23H30BNO4S |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 5-methyl-1-(4-methylphenyl)sulfonyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-2,3-dihydroindole |
| SMILES | Cc1ccc(S(=O)(=O)N2c3ccc(C)cc3CC2CB2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C23H30BNO4S/c1-16-7-10-20(11-8-16)30(26,27)25-19(14-18-13-17(2)9-12-21(18)25)15-24-28-22(3,4)23(5,6)29-24/h7-13,19H,14-15H2,1-6H3 |
| InChIKey | ROXFIGCWPBZFTA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|