C23H36BNO4S — CID 122216127
2-(4-methylphenyl)sulfonyl-3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-2-azaspiro[4.5]decane (PubChem CID 122216127) has the molecular formula C23H36BNO4S and a molecular weight of 433.42 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-2-azaspiro[4.5]decane.
| Compound Name | 2-(4-methylphenyl)sulfonyl-3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-2-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 122216127 |
| Molecular Formula | C23H36BNO4S |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-2-azaspiro[4.5]decane |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3(CCCCC3)CC2CB2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C23H36BNO4S/c1-18-9-11-20(12-10-18)30(26,27)25-17-23(13-7-6-8-14-23)15-19(25)16-24-28-21(2,3)22(4,5)29-24/h9-12,19H,6-8,13-17H2,1-5H3 |
| InChIKey | PPKQVEIXHUNKGV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|