C24H31NO2S2 — CID 132574259
3-[(4-methylphenyl)sulfanylmethyl]-2-(4-methylphenyl)sulfonyl-2-azaspiro[4.5]decane (PubChem CID 132574259) has the molecular formula C24H31NO2S2 and a molecular weight of 429.65 g/mol. Its IUPAC name is 3-[(4-methylphenyl)sulfanylmethyl]-2-(4-methylphenyl)sulfonyl-2-azaspiro[4.5]decane.
| Compound Name | 3-[(4-methylphenyl)sulfanylmethyl]-2-(4-methylphenyl)sulfonyl-2-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 132574259 |
| Molecular Formula | C24H31NO2S2 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 3-[(4-methylphenyl)sulfanylmethyl]-2-(4-methylphenyl)sulfonyl-2-azaspiro[4.5]decane |
| SMILES | Cc1ccc(SCC2CC3(CCCCC3)CN2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H31NO2S2/c1-19-6-10-22(11-7-19)28-17-21-16-24(14-4-3-5-15-24)18-25(21)29(26,27)23-12-8-20(2)9-13-23/h6-13,21H,3-5,14-18H2,1-2H3 |
| InChIKey | UADPQCQZNXHIAN-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |