C14H19NO2S — CID 168897842
6-(benzenesulfonyl)-7-methyl-6-azaspiro[3.4]octane (PubChem CID 168897842) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is 6-(benzenesulfonyl)-7-methyl-6-azaspiro[3.4]octane.
| Compound Name | 6-(benzenesulfonyl)-7-methyl-6-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 168897842 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 6-(benzenesulfonyl)-7-methyl-6-azaspiro[3.4]octane |
| SMILES | CC1CC2(CCC2)CN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H19NO2S/c1-12-10-14(8-5-9-14)11-15(12)18(16,17)13-6-3-2-4-7-13/h2-4,6-7,12H,5,8-11H2,1H3 |
| InChIKey | SBEUDXWUGWZHEL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |