C14H21NO2S — CID 24799740
1-(benzenesulfonyl)-2,5,5-trimethylpiperidine (PubChem CID 24799740) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2,5,5-trimethylpiperidine.
| Compound Name | 1-(benzenesulfonyl)-2,5,5-trimethylpiperidine |
|---|---|
| PubChem CID | 24799740 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 1-(benzenesulfonyl)-2,5,5-trimethylpiperidine |
| SMILES | CC1CCC(C)(C)CN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H21NO2S/c1-12-9-10-14(2,3)11-15(12)18(16,17)13-7-5-4-6-8-13/h4-8,12H,9-11H2,1-3H3 |
| InChIKey | MKGMVKCBHWVSSS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |