C12H17NO2S — CID 13427462
1-(benzenesulfonyl)-3,3-dimethylpyrrolidine (PubChem CID 13427462) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3,3-dimethylpyrrolidine.
| Compound Name | 1-(benzenesulfonyl)-3,3-dimethylpyrrolidine |
|---|---|
| PubChem CID | 13427462 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 1-(benzenesulfonyl)-3,3-dimethylpyrrolidine |
| SMILES | CC1(C)CCN(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C12H17NO2S/c1-12(2)8-9-13(10-12)16(14,15)11-6-4-3-5-7-11/h3-7H,8-10H2,1-2H3 |
| InChIKey | QOODDDKWUVEYKJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |