C16H22N2O3S — CID 97385294
1-[8-(benzenesulfonyl)-2,8-diazaspiro[4.5]decan-2-yl]ethanone (PubChem CID 97385294) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is 1-[8-(benzenesulfonyl)-2,8-diazaspiro[4.5]decan-2-yl]ethanone.
| Compound Name | 1-[8-(benzenesulfonyl)-2,8-diazaspiro[4.5]decan-2-yl]ethanone |
|---|---|
| PubChem CID | 97385294 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 1-[8-(benzenesulfonyl)-2,8-diazaspiro[4.5]decan-2-yl]ethanone |
| SMILES | CC(=O)N1CCC2(CCN(S(=O)(=O)c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C16H22N2O3S/c1-14(19)17-10-7-16(13-17)8-11-18(12-9-16)22(20,21)15-5-3-2-4-6-15/h2-6H,7-13H2,1H3 |
| InChIKey | OXVDPMHZBIKOGM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |