C12H19ClN2O2S — CID 120777513
[1-(benzenesulfonyl)-3-methylpyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 120777513) has the molecular formula C12H19ClN2O2S and a molecular weight of 290.82 g/mol. Its IUPAC name is [1-(benzenesulfonyl)-3-methylpyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [1-(benzenesulfonyl)-3-methylpyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120777513 |
| Molecular Formula | C12H19ClN2O2S |
| Molecular Weight | 290.82 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | [1-(benzenesulfonyl)-3-methylpyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | CC1(CN)CCN(S(=O)(=O)c2ccccc2)C1.Cl |
| InChI | InChI=1S/C12H18N2O2S.ClH/c1-12(9-13)7-8-14(10-12)17(15,16)11-5-3-2-4-6-11;/h2-6H,7-10,13H2,1H3;1H |
| InChIKey | VZHXPFCSDJCGLF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.82 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |