C15H23ClN2O4S — CID 120777681
ethyl 4-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]sulfonylbenzoate;hydrochloride (PubChem CID 120777681) has the molecular formula C15H23ClN2O4S and a molecular weight of 362.88 g/mol. Its IUPAC name is ethyl 4-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]sulfonylbenzoate;hydrochloride.
| Compound Name | ethyl 4-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]sulfonylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 120777681 |
| Molecular Formula | C15H23ClN2O4S |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | ethyl 4-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]sulfonylbenzoate;hydrochloride |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCC(C)(CN)C2)cc1.Cl |
| InChI | InChI=1S/C15H22N2O4S.ClH/c1-3-21-14(18)12-4-6-13(7-5-12)22(19,20)17-9-8-15(2,10-16)11-17;/h4-7H,3,8-11,16H2,1-2H3;1H |
| InChIKey | CWZVOJHOABXPDX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |