C13H20N2O4S2 — CID 120777820
[3-methyl-1-(2-methylsulfonylphenyl)sulfonylpyrrolidin-3-yl]methanamine (PubChem CID 120777820) has the molecular formula C13H20N2O4S2 and a molecular weight of 332.45 g/mol. Its IUPAC name is [3-methyl-1-(2-methylsulfonylphenyl)sulfonylpyrrolidin-3-yl]methanamine.
| Compound Name | [3-methyl-1-(2-methylsulfonylphenyl)sulfonylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 120777820 |
| Molecular Formula | C13H20N2O4S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | [3-methyl-1-(2-methylsulfonylphenyl)sulfonylpyrrolidin-3-yl]methanamine |
| SMILES | CC1(CN)CCN(S(=O)(=O)c2ccccc2S(C)(=O)=O)C1 |
| InChI | InChI=1S/C13H20N2O4S2/c1-13(9-14)7-8-15(10-13)21(18,19)12-6-4-3-5-11(12)20(2,16)17/h3-6H,7-10,14H2,1-2H3 |
| InChIKey | SZEPETGOWMUQLB-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |