C15H24NO6PS — CID 6565192
(2S,4R,5R)-1-(benzenesulfonyl)-4-dimethoxyphosphoryl-2,5-dimethylpiperidin-4-ol (PubChem CID 6565192) has the molecular formula C15H24NO6PS and a molecular weight of 377.40 g/mol. Its IUPAC name is (2S,4R,5R)-1-(benzenesulfonyl)-4-dimethoxyphosphoryl-2,5-dimethylpiperidin-4-ol.
| Compound Name | (2S,4R,5R)-1-(benzenesulfonyl)-4-dimethoxyphosphoryl-2,5-dimethylpiperidin-4-ol |
|---|---|
| PubChem CID | 6565192 |
| Molecular Formula | C15H24NO6PS |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | (2S,4R,5R)-1-(benzenesulfonyl)-4-dimethoxyphosphoryl-2,5-dimethylpiperidin-4-ol |
| SMILES | COP(=O)(OC)[C@]1(O)C[C@H](C)N(S(=O)(=O)c2ccccc2)C[C@H]1C |
| InChI | InChI=1S/C15H24NO6PS/c1-12-11-16(24(19,20)14-8-6-5-7-9-14)13(2)10-15(12,17)23(18,21-3)22-4/h5-9,12-13,17H,10-11H2,1-4H3/t12-,13+,15-/m1/s1 |
| InChIKey | DIKBDUBVWNETEF-VNHYZAJKSA-N |
| XLogP | 2.28 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|