C21H22ClIN2O3S — CID 101017858
1-[(3aS,4S,9bR)-8-chloro-4-(iodomethyl)-5-(4-methylphenyl)sulfonyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]ethanone (PubChem CID 101017858) has the molecular formula C21H22ClIN2O3S and a molecular weight of 544.84 g/mol. Its IUPAC name is 1-[(3aS,4S,9bR)-8-chloro-4-(iodomethyl)-5-(4-methylphenyl)sulfonyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]ethanone.
| Compound Name | 1-[(3aS,4S,9bR)-8-chloro-4-(iodomethyl)-5-(4-methylphenyl)sulfonyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]ethanone |
|---|---|
| PubChem CID | 101017858 |
| Molecular Formula | C21H22ClIN2O3S |
| Molecular Weight | 544.84 g/mol |
| Exact Mass | 544.01 |
| IUPAC Name | 1-[(3aS,4S,9bR)-8-chloro-4-(iodomethyl)-5-(4-methylphenyl)sulfonyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]ethanone |
| SMILES | CC(=O)N1CC[C@@H]2[C@@H](CI)N(S(=O)(=O)c3ccc(C)cc3)c3ccc(Cl)cc3[C@@H]21 |
| InChI | InChI=1S/C21H22ClIN2O3S/c1-13-3-6-16(7-4-13)29(27,28)25-19-8-5-15(22)11-18(19)21-17(20(25)12-23)9-10-24(21)14(2)26/h3-8,11,17,20-21H,9-10,12H2,1-2H3/t17-,20-,21-/m1/s1 |
| InChIKey | YYQWTJZEWQQDMM-DUXKGJEZSA-N |
| XLogP | 4.57 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.84 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|