C20H24N2O3S — CID 11349284
(3aS,4R,9bR)-4-ethyl-5-(4-methylphenyl)sulfonyl-1,2,3,3a,4,9b-hexahydropyrrolo[3,2-c]quinolin-8-ol (PubChem CID 11349284) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is (3aS,4R,9bR)-4-ethyl-5-(4-methylphenyl)sulfonyl-1,2,3,3a,4,9b-hexahydropyrrolo[3,2-c]quinolin-8-ol.
| Compound Name | (3aS,4R,9bR)-4-ethyl-5-(4-methylphenyl)sulfonyl-1,2,3,3a,4,9b-hexahydropyrrolo[3,2-c]quinolin-8-ol |
|---|---|
| PubChem CID | 11349284 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (3aS,4R,9bR)-4-ethyl-5-(4-methylphenyl)sulfonyl-1,2,3,3a,4,9b-hexahydropyrrolo[3,2-c]quinolin-8-ol |
| SMILES | CC[C@@H]1[C@H]2CCN[C@H]2c2cc(O)ccc2N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H24N2O3S/c1-3-18-16-10-11-21-20(16)17-12-14(23)6-9-19(17)22(18)26(24,25)15-7-4-13(2)5-8-15/h4-9,12,16,18,20-21,23H,3,10-11H2,1-2H3/t16-,18-,20-/m1/s1 |
| InChIKey | QOGRVKHRRBJGPL-YVWKXTFCSA-N |
| XLogP | 3.34 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |