C22H28BrN3O3S — CID 177360683
[5-cyano-2-hydroxy-1-(4-methylphenyl)sulfonyl-2,3-dihydroindol-3-yl]-triethylazanium bromide (PubChem CID 177360683) has the molecular formula C22H28BrN3O3S and a molecular weight of 494.46 g/mol. Its IUPAC name is [5-cyano-2-hydroxy-1-(4-methylphenyl)sulfonyl-2,3-dihydroindol-3-yl]-triethylazanium bromide.
| Compound Name | [5-cyano-2-hydroxy-1-(4-methylphenyl)sulfonyl-2,3-dihydroindol-3-yl]-triethylazanium bromide |
|---|---|
| PubChem CID | 177360683 |
| Molecular Formula | C22H28BrN3O3S |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | [5-cyano-2-hydroxy-1-(4-methylphenyl)sulfonyl-2,3-dihydroindol-3-yl]-triethylazanium bromide |
| SMILES | CC[N+](CC)(CC)C1c2cc(C#N)ccc2N(S(=O)(=O)c2ccc(C)cc2)C1O.[Br-] |
| InChI | InChI=1S/C22H28N3O3S.BrH/c1-5-25(6-2,7-3)21-19-14-17(15-23)10-13-20(19)24(22(21)26)29(27,28)18-11-8-16(4)9-12-18;/h8-14,21-22,26H,5-7H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | PJBZVZVQXSOGSP-UHFFFAOYSA-M |
| XLogP | 0.32 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|