C19H18ClNO5S — CID 12646133
methyl 8-chloro-1-(4-methylphenyl)sulfonyl-5-oxo-3,4-dihydro-2H-1-benzazepine-4-carboxylate (PubChem CID 12646133) has the molecular formula C19H18ClNO5S and a molecular weight of 407.88 g/mol. Its IUPAC name is methyl 8-chloro-1-(4-methylphenyl)sulfonyl-5-oxo-3,4-dihydro-2H-1-benzazepine-4-carboxylate.
| Compound Name | methyl 8-chloro-1-(4-methylphenyl)sulfonyl-5-oxo-3,4-dihydro-2H-1-benzazepine-4-carboxylate |
|---|---|
| PubChem CID | 12646133 |
| Molecular Formula | C19H18ClNO5S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | methyl 8-chloro-1-(4-methylphenyl)sulfonyl-5-oxo-3,4-dihydro-2H-1-benzazepine-4-carboxylate |
| SMILES | COC(=O)C1CCN(S(=O)(=O)c2ccc(C)cc2)c2cc(Cl)ccc2C1=O |
| InChI | InChI=1S/C19H18ClNO5S/c1-12-3-6-14(7-4-12)27(24,25)21-10-9-16(19(23)26-2)18(22)15-8-5-13(20)11-17(15)21/h3-8,11,16H,9-10H2,1-2H3 |
| InChIKey | XUANVXVWMAQZEY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|