C14H15NO5S — CID 11381307
methyl 1-(4-methylphenyl)sulfonyl-6-oxo-2,3-dihydropyridine-5-carboxylate (PubChem CID 11381307) has the molecular formula C14H15NO5S and a molecular weight of 309.34 g/mol. Its IUPAC name is methyl 1-(4-methylphenyl)sulfonyl-6-oxo-2,3-dihydropyridine-5-carboxylate.
| Compound Name | methyl 1-(4-methylphenyl)sulfonyl-6-oxo-2,3-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 11381307 |
| Molecular Formula | C14H15NO5S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | methyl 1-(4-methylphenyl)sulfonyl-6-oxo-2,3-dihydropyridine-5-carboxylate |
| SMILES | COC(=O)C1=CCCN(S(=O)(=O)c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C14H15NO5S/c1-10-5-7-11(8-6-10)21(18,19)15-9-3-4-12(13(15)16)14(17)20-2/h4-8H,3,9H2,1-2H3 |
| InChIKey | IACWOBQSFRBRNJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|