C20H25NO4SSi — CID 11069487
methyl 1-(4-methylphenyl)sulfonyl-7-trimethylsilyl-2,3-dihydroindole-4-carboxylate (PubChem CID 11069487) has the molecular formula C20H25NO4SSi and a molecular weight of 403.58 g/mol. Its IUPAC name is methyl 1-(4-methylphenyl)sulfonyl-7-trimethylsilyl-2,3-dihydroindole-4-carboxylate.
| Compound Name | methyl 1-(4-methylphenyl)sulfonyl-7-trimethylsilyl-2,3-dihydroindole-4-carboxylate |
|---|---|
| PubChem CID | 11069487 |
| Molecular Formula | C20H25NO4SSi |
| Molecular Weight | 403.58 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | methyl 1-(4-methylphenyl)sulfonyl-7-trimethylsilyl-2,3-dihydroindole-4-carboxylate |
| SMILES | COC(=O)c1ccc([Si](C)(C)C)c2c1CCN2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H25NO4SSi/c1-14-6-8-15(9-7-14)26(23,24)21-13-12-16-17(20(22)25-2)10-11-18(19(16)21)27(3,4)5/h6-11H,12-13H2,1-5H3 |
| InChIKey | ZWURZGBUZHJZMY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.58 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|