C25H28N2O4SSi — CID 102524464
benzyl 1-(4-methylphenyl)sulfonyl-7-trimethylsilyl-2,3-dihydropyrrolo[2,3-c]pyridine-5-carboxylate (PubChem CID 102524464) has the molecular formula C25H28N2O4SSi and a molecular weight of 480.66 g/mol. Its IUPAC name is benzyl 1-(4-methylphenyl)sulfonyl-7-trimethylsilyl-2,3-dihydropyrrolo[2,3-c]pyridine-5-carboxylate.
| Compound Name | benzyl 1-(4-methylphenyl)sulfonyl-7-trimethylsilyl-2,3-dihydropyrrolo[2,3-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 102524464 |
| Molecular Formula | C25H28N2O4SSi |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | benzyl 1-(4-methylphenyl)sulfonyl-7-trimethylsilyl-2,3-dihydropyrrolo[2,3-c]pyridine-5-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCc3cc(C(=O)OCc4ccccc4)nc([Si](C)(C)C)c32)cc1 |
| InChI | InChI=1S/C25H28N2O4SSi/c1-18-10-12-21(13-11-18)32(29,30)27-15-14-20-16-22(26-24(23(20)27)33(2,3)4)25(28)31-17-19-8-6-5-7-9-19/h5-13,16H,14-15,17H2,1-4H3 |
| InChIKey | SWXFKFNFTKLGCD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|