C27H31NO2SSi — CID 102144523
benzyl-dimethyl-[1-(4-methylphenyl)sulfonyl-3,6,7,8-tetrahydro-2H-cyclopenta[g]indol-5-yl]silane (PubChem CID 102144523) has the molecular formula C27H31NO2SSi and a molecular weight of 461.70 g/mol. Its IUPAC name is benzyl-dimethyl-[1-(4-methylphenyl)sulfonyl-3,6,7,8-tetrahydro-2H-cyclopenta[g]indol-5-yl]silane.
| Compound Name | benzyl-dimethyl-[1-(4-methylphenyl)sulfonyl-3,6,7,8-tetrahydro-2H-cyclopenta[g]indol-5-yl]silane |
|---|---|
| PubChem CID | 102144523 |
| Molecular Formula | C27H31NO2SSi |
| Molecular Weight | 461.70 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | benzyl-dimethyl-[1-(4-methylphenyl)sulfonyl-3,6,7,8-tetrahydro-2H-cyclopenta[g]indol-5-yl]silane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCc3cc([Si](C)(C)Cc4ccccc4)c4c(c32)CCC4)cc1 |
| InChI | InChI=1S/C27H31NO2SSi/c1-20-12-14-23(15-13-20)31(29,30)28-17-16-22-18-26(24-10-7-11-25(24)27(22)28)32(2,3)19-21-8-5-4-6-9-21/h4-6,8-9,12-15,18H,7,10-11,16-17,19H2,1-3H3 |
| InChIKey | MZBBLOMHMSFZHT-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.70 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|