C17H21NO3SSi — CID 101058095
1-(4-methylphenyl)sulfonyl-4-trimethylsilyl-2,3-dihydrocyclopenta[b]pyrrol-5-one (PubChem CID 101058095) has the molecular formula C17H21NO3SSi and a molecular weight of 347.51 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-4-trimethylsilyl-2,3-dihydrocyclopenta[b]pyrrol-5-one.
| Compound Name | 1-(4-methylphenyl)sulfonyl-4-trimethylsilyl-2,3-dihydrocyclopenta[b]pyrrol-5-one |
|---|---|
| PubChem CID | 101058095 |
| Molecular Formula | C17H21NO3SSi |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-4-trimethylsilyl-2,3-dihydrocyclopenta[b]pyrrol-5-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC3=C([Si](C)(C)C)C(=O)C=C32)cc1 |
| InChI | InChI=1S/C17H21NO3SSi/c1-12-5-7-13(8-6-12)22(20,21)18-10-9-14-15(18)11-16(19)17(14)23(2,3)4/h5-8,11H,9-10H2,1-4H3 |
| InChIKey | OUKOPYJWDLIBCI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|