C12H17IN2O2S — CID 11485790
1,2-dimethyl-3-(4-methylphenyl)sulfonyl-4,5-dihydroimidazol-1-ium iodide (PubChem CID 11485790) has the molecular formula C12H17IN2O2S and a molecular weight of 380.25 g/mol. Its IUPAC name is 1,2-dimethyl-3-(4-methylphenyl)sulfonyl-4,5-dihydroimidazol-1-ium iodide.
| Compound Name | 1,2-dimethyl-3-(4-methylphenyl)sulfonyl-4,5-dihydroimidazol-1-ium iodide |
|---|---|
| PubChem CID | 11485790 |
| Molecular Formula | C12H17IN2O2S |
| Molecular Weight | 380.25 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | 1,2-dimethyl-3-(4-methylphenyl)sulfonyl-4,5-dihydroimidazol-1-ium iodide |
| SMILES | CC1=[N+](C)CCN1S(=O)(=O)c1ccc(C)cc1.[I-] |
| InChI | InChI=1S/C12H17N2O2S.HI/c1-10-4-6-12(7-5-10)17(15,16)14-9-8-13(3)11(14)2;/h4-7H,8-9H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | ZZRALASWMVUZIE-UHFFFAOYSA-M |
| XLogP | -1.94 |
| TPSA | 40.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.25 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|