C20H25NO3SSi — CID 135063034
(4S)-4-[dimethyl(phenyl)silyl]-1-(4-methylphenyl)sulfonylpiperidin-2-one (PubChem CID 135063034) has the molecular formula C20H25NO3SSi and a molecular weight of 387.58 g/mol. Its IUPAC name is (4S)-4-[dimethyl(phenyl)silyl]-1-(4-methylphenyl)sulfonylpiperidin-2-one.
| Compound Name | (4S)-4-[dimethyl(phenyl)silyl]-1-(4-methylphenyl)sulfonylpiperidin-2-one |
|---|---|
| PubChem CID | 135063034 |
| Molecular Formula | C20H25NO3SSi |
| Molecular Weight | 387.58 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | (4S)-4-[dimethyl(phenyl)silyl]-1-(4-methylphenyl)sulfonylpiperidin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@H]([Si](C)(C)c3ccccc3)CC2=O)cc1 |
| InChI | InChI=1S/C20H25NO3SSi/c1-16-9-11-17(12-10-16)25(23,24)21-14-13-19(15-20(21)22)26(2,3)18-7-5-4-6-8-18/h4-12,19H,13-15H2,1-3H3/t19-/m0/s1 |
| InChIKey | KXXGDFHJJQLCQI-IBGZPJMESA-N |
| XLogP | 3.29 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.58 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|