C29H27NO3PS+ — CID 22403580
[1-(4-methylphenyl)sulfonyl-2-oxopyrrolidin-3-yl]-triphenylphosphanium (PubChem CID 22403580) has the molecular formula C29H27NO3PS+ and a molecular weight of 500.58 g/mol. Its IUPAC name is [1-(4-methylphenyl)sulfonyl-2-oxopyrrolidin-3-yl]-triphenylphosphanium.
| Compound Name | [1-(4-methylphenyl)sulfonyl-2-oxopyrrolidin-3-yl]-triphenylphosphanium |
|---|---|
| PubChem CID | 22403580 |
| Molecular Formula | C29H27NO3PS+ |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | [1-(4-methylphenyl)sulfonyl-2-oxopyrrolidin-3-yl]-triphenylphosphanium |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC([P+](c3ccccc3)(c3ccccc3)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C29H27NO3PS/c1-23-17-19-27(20-18-23)35(32,33)30-22-21-28(29(30)31)34(24-11-5-2-6-12-24,25-13-7-3-8-14-25)26-15-9-4-10-16-26/h2-20,28H,21-22H2,1H3/q+1 |
| InChIKey | NUZMKPQIZOWLGN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|