C22H21BrNO2P — CID 11797445
(1-hydroxy-2-oxopyrrolidin-3-yl)-triphenylphosphanium bromide (PubChem CID 11797445) has the molecular formula C22H21BrNO2P and a molecular weight of 442.29 g/mol. Its IUPAC name is (1-hydroxy-2-oxopyrrolidin-3-yl)-triphenylphosphanium bromide.
| Compound Name | (1-hydroxy-2-oxopyrrolidin-3-yl)-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 11797445 |
| Molecular Formula | C22H21BrNO2P |
| Molecular Weight | 442.29 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | (1-hydroxy-2-oxopyrrolidin-3-yl)-triphenylphosphanium bromide |
| SMILES | O=C1C([P+](c2ccccc2)(c2ccccc2)c2ccccc2)CCN1O.[Br-] |
| InChI | InChI=1S/C22H21NO2P.BrH/c24-22-21(16-17-23(22)25)26(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20;/h1-15,21,25H,16-17H2;1H/q+1;/p-1 |
| InChIKey | KWLHISNOKNVRSU-UHFFFAOYSA-M |
| XLogP | -0.03 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.29 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|