C28H24BrN2O3P — CID 10602672
[1-(3-nitrophenyl)-2-oxopyrrolidin-3-yl]-triphenylphosphanium bromide (PubChem CID 10602672) has the molecular formula C28H24BrN2O3P and a molecular weight of 547.39 g/mol. Its IUPAC name is [1-(3-nitrophenyl)-2-oxopyrrolidin-3-yl]-triphenylphosphanium bromide.
| Compound Name | [1-(3-nitrophenyl)-2-oxopyrrolidin-3-yl]-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 10602672 |
| Molecular Formula | C28H24BrN2O3P |
| Molecular Weight | 547.39 g/mol |
| Exact Mass | 546.07 |
| IUPAC Name | [1-(3-nitrophenyl)-2-oxopyrrolidin-3-yl]-triphenylphosphanium bromide |
| SMILES | O=C1C([P+](c2ccccc2)(c2ccccc2)c2ccccc2)CCN1c1cccc([N+](=O)[O-])c1.[Br-] |
| InChI | InChI=1S/C28H24N2O3P.BrH/c31-28-27(19-20-29(28)22-11-10-12-23(21-22)30(32)33)34(24-13-4-1-5-14-24,25-15-6-2-7-16-25)26-17-8-3-9-18-26;/h1-18,21,27H,19-20H2;1H/q+1;/p-1 |
| InChIKey | MLYSHXBRKDCIDM-UHFFFAOYSA-M |
| XLogP | 1.70 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|