C12H10N4O3S2 — CID 95187819
(3R)-1-(3-nitrophenyl)-3-(1,3,4-thiadiazol-2-ylsulfanyl)pyrrolidin-2-one (PubChem CID 95187819) has the molecular formula C12H10N4O3S2 and a molecular weight of 322.37 g/mol. Its IUPAC name is (3R)-1-(3-nitrophenyl)-3-(1,3,4-thiadiazol-2-ylsulfanyl)pyrrolidin-2-one.
| Compound Name | (3R)-1-(3-nitrophenyl)-3-(1,3,4-thiadiazol-2-ylsulfanyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 95187819 |
| Molecular Formula | C12H10N4O3S2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | (3R)-1-(3-nitrophenyl)-3-(1,3,4-thiadiazol-2-ylsulfanyl)pyrrolidin-2-one |
| SMILES | O=C1[C@H](Sc2nncs2)CCN1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H10N4O3S2/c17-11-10(21-12-14-13-7-20-12)4-5-15(11)8-2-1-3-9(6-8)16(18)19/h1-3,6-7,10H,4-5H2/t10-/m1/s1 |
| InChIKey | MDDQEOBLWZRIOO-SNVBAGLBSA-N |
| XLogP | 2.34 |
| TPSA | 89.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|