About 1-(3-nitrophenyl)-3-(1,3,4-thiadiazol-2-ylsulfanyl)pyrrolidin-2-one
1-(3-nitrophenyl)-3-(1,3,4-thiadiazol-2-ylsulfanyl)pyrrolidin-2-one (PubChem CID 56785019) has the molecular formula C12H10N4O3S2
and a molecular weight of 322.37 g/mol. Its IUPAC name is 1-(3-nitrophenyl)-3-(1,3,4-thiadiazol-2-ylsulfanyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-(3-nitrophenyl)-3-(1,3,4-thiadiazol-2-ylsulfanyl)pyrrolidin-2-one |
| PubChem CID | 56785019 |
| Molecular Formula | C12H10N4O3S2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 1-(3-nitrophenyl)-3-(1,3,4-thiadiazol-2-ylsulfanyl)pyrrolidin-2-one |
| SMILES | O=C1C(Sc2nncs2)CCN1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H10N4O3S2/c17-11-10(21-12-14-13-7-20-12)4-5-15(11)8-2-1-3-9(6-8)16(18)19/h1-3,6-7,10H,4-5H2 |
| InChIKey | MDDQEOBLWZRIOO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 89.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-nitrophenyl)-3-(1,3,4-thiadiazol-2-ylsulfanyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-nitrophenyl)-3-(1,3,4-thiadiazol-2-ylsulfanyl)pyrrolidin-2-one?
The IUPAC name of 1-(3-nitrophenyl)-3-(1,3,4-thiadiazol-2-ylsulfanyl)pyrrolidin-2-one (CID 56785019) is 1-(3-nitrophenyl)-3-(1,3,4-thiadiazol-2-ylsulfanyl)pyrrolidin-2-one.
What is the SMILES notation for 1-(3-nitrophenyl)-3-(1,3,4-thiadiazol-2-ylsulfanyl)pyrrolidin-2-one?
The canonical SMILES for 1-(3-nitrophenyl)-3-(1,3,4-thiadiazol-2-ylsulfanyl)pyrrolidin-2-one is O=C1C(Sc2nncs2)CCN1c1cccc([N+](=O)[O-])c1.
What is the InChIKey of 1-(3-nitrophenyl)-3-(1,3,4-thiadiazol-2-ylsulfanyl)pyrrolidin-2-one?
The InChIKey is MDDQEOBLWZRIOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4O3S2/c17-11-10(21-12-14-13-7-20-12)4-5-15(11)8-2-1-3-9(6-8)16(18)19/h1-3,6-7,10H,4-5H2.
What are the key properties of 1-(3-nitrophenyl)-3-(1,3,4-thiadiazol-2-ylsulfanyl)pyrrolidin-2-one?
1-(3-nitrophenyl)-3-(1,3,4-thiadiazol-2-ylsulfanyl)pyrrolidin-2-one has a molecular weight of 322.37 g/mol, XLogP of 2.34, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-nitrophenyl)-3-(1,3,4-thiadiazol-2-ylsulfanyl)pyrrolidin-2-one is sourced from PubChem (CID 56785019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).