C15H15N5O3S — CID 95187827
(3S)-3-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-(3-nitrophenyl)pyrrolidin-2-one (PubChem CID 95187827) has the molecular formula C15H15N5O3S and a molecular weight of 345.38 g/mol. Its IUPAC name is (3S)-3-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-(3-nitrophenyl)pyrrolidin-2-one.
| Compound Name | (3S)-3-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-(3-nitrophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 95187827 |
| Molecular Formula | C15H15N5O3S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | (3S)-3-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-1-(3-nitrophenyl)pyrrolidin-2-one |
| SMILES | Cc1cc(N)nc(S[C@H]2CCN(c3cccc([N+](=O)[O-])c3)C2=O)n1 |
| InChI | InChI=1S/C15H15N5O3S/c1-9-7-13(16)18-15(17-9)24-12-5-6-19(14(12)21)10-3-2-4-11(8-10)20(22)23/h2-4,7-8,12H,5-6H2,1H3,(H2,16,17,18)/t12-/m0/s1 |
| InChIKey | GUTYSVBGQPTXJI-LBPRGKRZSA-N |
| XLogP | 2.17 |
| TPSA | 115.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|