C26H27BrNOP — CID 22403717
(1-cyclopropyl-2-oxopiperidin-3-yl)-triphenylphosphanium bromide (PubChem CID 22403717) has the molecular formula C26H27BrNOP and a molecular weight of 480.39 g/mol. Its IUPAC name is (1-cyclopropyl-2-oxopiperidin-3-yl)-triphenylphosphanium bromide.
| Compound Name | (1-cyclopropyl-2-oxopiperidin-3-yl)-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 22403717 |
| Molecular Formula | C26H27BrNOP |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | (1-cyclopropyl-2-oxopiperidin-3-yl)-triphenylphosphanium bromide |
| SMILES | O=C1C([P+](c2ccccc2)(c2ccccc2)c2ccccc2)CCCN1C1CC1.[Br-] |
| InChI | InChI=1S/C26H27NOP.BrH/c28-26-25(17-10-20-27(26)21-18-19-21)29(22-11-4-1-5-12-22,23-13-6-2-7-14-23)24-15-8-3-9-16-24;/h1-9,11-16,21,25H,10,17-20H2;1H/q+1;/p-1 |
| InChIKey | VUMANFFJIMAZBE-UHFFFAOYSA-M |
| XLogP | 1.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|