C30H32N2O3P+ — CID 18394663
[(3S)-2-oxo-1-(1-prop-2-enoxycarbonylpyrrolidin-3-yl)pyrrolidin-3-yl]-triphenylphosphanium (PubChem CID 18394663) has the molecular formula C30H32N2O3P+ and a molecular weight of 499.57 g/mol. Its IUPAC name is [(3S)-2-oxo-1-(1-prop-2-enoxycarbonylpyrrolidin-3-yl)pyrrolidin-3-yl]-triphenylphosphanium.
| Compound Name | [(3S)-2-oxo-1-(1-prop-2-enoxycarbonylpyrrolidin-3-yl)pyrrolidin-3-yl]-triphenylphosphanium |
|---|---|
| PubChem CID | 18394663 |
| Molecular Formula | C30H32N2O3P+ |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | [(3S)-2-oxo-1-(1-prop-2-enoxycarbonylpyrrolidin-3-yl)pyrrolidin-3-yl]-triphenylphosphanium |
| SMILES | C=CCOC(=O)N1CCC(N2CC[C@H]([P+](c3ccccc3)(c3ccccc3)c3ccccc3)C2=O)C1 |
| InChI | InChI=1S/C30H32N2O3P/c1-2-22-35-30(34)31-20-18-24(23-31)32-21-19-28(29(32)33)36(25-12-6-3-7-13-25,26-14-8-4-9-15-26)27-16-10-5-11-17-27/h2-17,24,28H,1,18-23H2/q+1/t24?,28-/m0/s1 |
| InChIKey | JXHXLMMDMBGSMN-AZKKKJBWSA-N |
| XLogP | 3.98 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|