C35H48N2O3P+ — CID 142115012
ethane;[1-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]-2-oxopyrrolidin-3-yl]-[(3Z,5Z)-octa-3,5,7-trien-2-yl]-diphenylphosphanium (PubChem CID 142115012) has the molecular formula C35H48N2O3P+ and a molecular weight of 575.75 g/mol. Its IUPAC name is ethane;[1-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]-2-oxopyrrolidin-3-yl]-[(3Z,5Z)-octa-3,5,7-trien-2-yl]-diphenylphosphanium.
| Compound Name | ethane;[1-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]-2-oxopyrrolidin-3-yl]-[(3Z,5Z)-octa-3,5,7-trien-2-yl]-diphenylphosphanium |
|---|---|
| PubChem CID | 142115012 |
| Molecular Formula | C35H48N2O3P+ |
| Molecular Weight | 575.75 g/mol |
| Exact Mass | 575.34 |
| IUPAC Name | ethane;[1-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]-2-oxopyrrolidin-3-yl]-[(3Z,5Z)-octa-3,5,7-trien-2-yl]-diphenylphosphanium |
| SMILES | C=C/C=C\C=C/C(C)[P+](c1ccccc1)(c1ccccc1)C1CCN(C2CCN(C(=O)OC(C)(C)C)C2)C1=O.CC |
| InChI | InChI=1S/C33H42N2O3P.C2H6/c1-6-7-8-11-16-26(2)39(28-17-12-9-13-18-28,29-19-14-10-15-20-29)30-22-24-35(31(30)36)27-21-23-34(25-27)32(37)38-33(3,4)5;1-2/h6-20,26-27,30H,1,21-25H2,2-5H3;1-2H3/q+1;/b8-7-,16-11-; |
| InChIKey | KDEQLYIUYFZJGI-JSYHLYROSA-N |
| XLogP | 6.98 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.75 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|