C30H32BrN2O3P — CID 140580447
prop-2-enyl 3-[3-[bromo(triphenyl)-λ5-phosphanyl]-2-oxopyrrolidin-1-yl]pyrrolidine-1-carboxylate (PubChem CID 140580447) has the molecular formula C30H32BrN2O3P and a molecular weight of 579.48 g/mol. Its IUPAC name is prop-2-enyl 3-[3-[bromo(triphenyl)-λ5-phosphanyl]-2-oxopyrrolidin-1-yl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl 3-[3-[bromo(triphenyl)-λ5-phosphanyl]-2-oxopyrrolidin-1-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 140580447 |
| Molecular Formula | C30H32BrN2O3P |
| Molecular Weight | 579.48 g/mol |
| Exact Mass | 578.13 |
| IUPAC Name | prop-2-enyl 3-[3-[bromo(triphenyl)-λ5-phosphanyl]-2-oxopyrrolidin-1-yl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCC(N2CCC(P(Br)(c3ccccc3)(c3ccccc3)c3ccccc3)C2=O)C1 |
| InChI | InChI=1S/C30H32BrN2O3P/c1-2-22-36-30(35)32-20-18-24(23-32)33-21-19-28(29(33)34)37(31,25-12-6-3-7-13-25,26-14-8-4-9-15-26)27-16-10-5-11-17-27/h2-17,24,28H,1,18-23H2 |
| InChIKey | BOOGEZFGGINLSG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|