C21H25N3O5 — CID 108562084
prop-2-enyl 4-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]piperidine-1-carboxylate (PubChem CID 108562084) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is prop-2-enyl 4-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]piperidine-1-carboxylate.
| Compound Name | prop-2-enyl 4-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108562084 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | prop-2-enyl 4-[4-(1,3-dioxoisoindol-2-yl)butanoylamino]piperidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CCC(NC(=O)CCCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C21H25N3O5/c1-2-14-29-21(28)23-12-9-15(10-13-23)22-18(25)8-5-11-24-19(26)16-6-3-4-7-17(16)20(24)27/h2-4,6-7,15H,1,5,8-14H2,(H,22,25) |
| InChIKey | IJYHLJDJSIJBGW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|