C26H29N3O7 — CID 27929428
ethyl 4-[[2-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoyloxy]acetyl]amino]piperidine-1-carboxylate (PubChem CID 27929428) has the molecular formula C26H29N3O7 and a molecular weight of 495.53 g/mol. Its IUPAC name is ethyl 4-[[2-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoyloxy]acetyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoyloxy]acetyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 27929428 |
| Molecular Formula | C26H29N3O7 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | ethyl 4-[[2-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoyloxy]acetyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)COC(=O)CCCN2C(=O)c3cccc4cccc(c34)C2=O)CC1 |
| InChI | InChI=1S/C26H29N3O7/c1-2-35-26(34)28-14-11-18(12-15-28)27-21(30)16-36-22(31)10-5-13-29-24(32)19-8-3-6-17-7-4-9-20(23(17)19)25(29)33/h3-4,6-9,18H,2,5,10-16H2,1H3,(H,27,30) |
| InChIKey | UFJYOOUEJWPVIS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|