C23H24N2O7S — CID 40783637
[2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate (PubChem CID 40783637) has the molecular formula C23H24N2O7S and a molecular weight of 472.52 g/mol. Its IUPAC name is [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate.
| Compound Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate |
|---|---|
| PubChem CID | 40783637 |
| Molecular Formula | C23H24N2O7S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoate |
| SMILES | CN(C(=O)COC(=O)CCCN1C(=O)c2cccc3cccc(c23)C1=O)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C23H24N2O7S/c1-24(16-10-12-33(30,31)14-16)19(26)13-32-20(27)9-4-11-25-22(28)17-7-2-5-15-6-3-8-18(21(15)17)23(25)29/h2-3,5-8,16H,4,9-14H2,1H3/t16-/m0/s1 |
| InChIKey | XWHQRLNCUJKWMB-INIZCTEOSA-N |
| XLogP | 1.40 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|