C15H15FN2O5S — CID 113201654
N-(1,1-dioxothiolan-3-yl)-2-(4-fluoro-1,3-dioxoisoindol-2-yl)-N-methylacetamide (PubChem CID 113201654) has the molecular formula C15H15FN2O5S and a molecular weight of 354.36 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(4-fluoro-1,3-dioxoisoindol-2-yl)-N-methylacetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(4-fluoro-1,3-dioxoisoindol-2-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 113201654 |
| Molecular Formula | C15H15FN2O5S |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(4-fluoro-1,3-dioxoisoindol-2-yl)-N-methylacetamide |
| SMILES | CN(C(=O)CN1C(=O)c2cccc(F)c2C1=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H15FN2O5S/c1-17(9-5-6-24(22,23)8-9)12(19)7-18-14(20)10-3-2-4-11(16)13(10)15(18)21/h2-4,9H,5-8H2,1H3 |
| InChIKey | MZIFJCOYPINPOS-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|