C20H29N3O7 — CID 55398630
ethyl 4-[[2-[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]oxyacetyl]amino]piperidine-1-carboxylate (PubChem CID 55398630) has the molecular formula C20H29N3O7 and a molecular weight of 423.47 g/mol. Its IUPAC name is ethyl 4-[[2-[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]oxyacetyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]oxyacetyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 55398630 |
| Molecular Formula | C20H29N3O7 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | ethyl 4-[[2-[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]oxyacetyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)COC(=O)CN2C(=O)C3CCCCC3C2=O)CC1 |
| InChI | InChI=1S/C20H29N3O7/c1-2-29-20(28)22-9-7-13(8-10-22)21-16(24)12-30-17(25)11-23-18(26)14-5-3-4-6-15(14)19(23)27/h13-15H,2-12H2,1H3,(H,21,24) |
| InChIKey | JYEUSAZPFDBOEC-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|