C14H23N3O4 — CID 110689912
ethyl 4-[[2-(2-oxopyrrolidin-1-yl)acetyl]amino]piperidine-1-carboxylate (PubChem CID 110689912) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is ethyl 4-[[2-(2-oxopyrrolidin-1-yl)acetyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-(2-oxopyrrolidin-1-yl)acetyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110689912 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | ethyl 4-[[2-(2-oxopyrrolidin-1-yl)acetyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)CN2CCCC2=O)CC1 |
| InChI | InChI=1S/C14H23N3O4/c1-2-21-14(20)16-8-5-11(6-9-16)15-12(18)10-17-7-3-4-13(17)19/h11H,2-10H2,1H3,(H,15,18) |
| InChIKey | WELSEANABWAYBI-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |